C24H23NO2 — CID 6581587
(3R)-5'-methoxy-1',3',3'-trimethylspiro[benzo[f]chromene-3,2'-indole] (PubChem CID 6581587) has the molecular formula C24H23NO2 and a molecular weight of 357.45 g/mol. Its IUPAC name is (3R)-5'-methoxy-1',3',3'-trimethylspiro[benzo[f]chromene-3,2'-indole].
| Compound Name | (3R)-5'-methoxy-1',3',3'-trimethylspiro[benzo[f]chromene-3,2'-indole] |
|---|---|
| PubChem CID | 6581587 |
| Molecular Formula | C24H23NO2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | (3R)-5'-methoxy-1',3',3'-trimethylspiro[benzo[f]chromene-3,2'-indole] |
| SMILES | COc1ccc2c(c1)C(C)(C)[C@]1(C=Cc3c(ccc4ccccc34)O1)N2C |
| InChI | InChI=1S/C24H23NO2/c1-23(2)20-15-17(26-4)10-11-21(20)25(3)24(23)14-13-19-18-8-6-5-7-16(18)9-12-22(19)27-24/h5-15H,1-4H3/t24-/m1/s1 |
| InChIKey | NQATYCIDEOBKIP-XMMPIXPASA-N |
| XLogP | 5.38 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|