C16H18N4O4 — CID 658198
8-[(3-methoxyphenyl)methoxy]-1,3,7-trimethylpurine-2,6-dione (PubChem CID 658198) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is 8-[(3-methoxyphenyl)methoxy]-1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 8-[(3-methoxyphenyl)methoxy]-1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 658198 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 8-[(3-methoxyphenyl)methoxy]-1,3,7-trimethylpurine-2,6-dione |
| SMILES | COc1cccc(COc2nc3c(c(=O)n(C)c(=O)n3C)n2C)c1 |
| InChI | InChI=1S/C16H18N4O4/c1-18-12-13(19(2)16(22)20(3)14(12)21)17-15(18)24-9-10-6-5-7-11(8-10)23-4/h5-8H,9H2,1-4H3 |
| InChIKey | SDEMBXFOALFRQD-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |