C16H17F3N2O4 — CID 658253
ethyl 2-benzamido-3,3,3-trifluoro-2-(2-oxopyrrolidin-1-yl)propanoate (PubChem CID 658253) has the molecular formula C16H17F3N2O4 and a molecular weight of 358.32 g/mol. Its IUPAC name is ethyl 2-benzamido-3,3,3-trifluoro-2-(2-oxopyrrolidin-1-yl)propanoate.
| Compound Name | ethyl 2-benzamido-3,3,3-trifluoro-2-(2-oxopyrrolidin-1-yl)propanoate |
|---|---|
| PubChem CID | 658253 |
| Molecular Formula | C16H17F3N2O4 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | ethyl 2-benzamido-3,3,3-trifluoro-2-(2-oxopyrrolidin-1-yl)propanoate |
| SMILES | CCOC(=O)C(NC(=O)c1ccccc1)(N1CCCC1=O)C(F)(F)F |
| InChI | InChI=1S/C16H17F3N2O4/c1-2-25-14(24)15(16(17,18)19,21-10-6-9-12(21)22)20-13(23)11-7-4-3-5-8-11/h3-5,7-8H,2,6,9-10H2,1H3,(H,20,23) |
| InChIKey | YQRHOYCMBWOFHL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |