C14H17N3OS — CID 658278
4,4-dimethyl-5-oxa-8-thia-10,15-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10-trien-16-imine (PubChem CID 658278) has the molecular formula C14H17N3OS and a molecular weight of 275.38 g/mol. Its IUPAC name is 4,4-dimethyl-5-oxa-8-thia-10,15-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10-trien-16-imine.
| Compound Name | 4,4-dimethyl-5-oxa-8-thia-10,15-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10-trien-16-imine |
|---|---|
| PubChem CID | 658278 |
| Molecular Formula | C14H17N3OS |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 4,4-dimethyl-5-oxa-8-thia-10,15-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10-trien-16-imine |
| SMILES | [H]/N=c1/c2c3c(sc2nc2n1CCC2)COC(C)(C)C3 |
| InChI | InChI=1S/C14H17N3OS/c1-14(2)6-8-9(7-18-14)19-13-11(8)12(15)17-5-3-4-10(17)16-13/h15H,3-7H2,1-2H3/b15-12- |
| InChIKey | LBOAJIJRQPHVFH-QINSGFPZSA-N |
| XLogP | 2.37 |
| TPSA | 50.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |