C13H15N3OS — CID 658303
14,14-dimethyl-13-oxa-10-thia-3,6,8-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraene (PubChem CID 658303) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is 14,14-dimethyl-13-oxa-10-thia-3,6,8-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraene.
| Compound Name | 14,14-dimethyl-13-oxa-10-thia-3,6,8-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraene |
|---|---|
| PubChem CID | 658303 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 14,14-dimethyl-13-oxa-10-thia-3,6,8-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraene |
| SMILES | CC1(C)Cc2c(sc3c2C2=NCCN2C=N3)CO1 |
| InChI | InChI=1S/C13H15N3OS/c1-13(2)5-8-9(6-17-13)18-12-10(8)11-14-3-4-16(11)7-15-12/h7H,3-6H2,1-2H3 |
| InChIKey | YEXLDLBPZSRCKK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |