C14H24N8O — CID 658316
2-[cyano-[4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]-N,N-dimethylpropanamide (PubChem CID 658316) has the molecular formula C14H24N8O and a molecular weight of 320.40 g/mol. Its IUPAC name is 2-[cyano-[4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]-N,N-dimethylpropanamide.
| Compound Name | 2-[cyano-[4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 658316 |
| Molecular Formula | C14H24N8O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 2-[cyano-[4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]-N,N-dimethylpropanamide |
| SMILES | CCNc1nc(NC(C)C)nc(N(C#N)C(C)C(=O)N(C)C)n1 |
| InChI | InChI=1S/C14H24N8O/c1-7-16-12-18-13(17-9(2)3)20-14(19-12)22(8-15)10(4)11(23)21(5)6/h9-10H,7H2,1-6H3,(H2,16,17,18,19,20) |
| InChIKey | NNTNLSWRYAEVFN-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 110.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|