C16H19NO2 — CID 658349
methyl 2-(6-methyl-1,2,3,4-tetrahydrocarbazol-9-yl)acetate (PubChem CID 658349) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is methyl 2-(6-methyl-1,2,3,4-tetrahydrocarbazol-9-yl)acetate.
| Compound Name | methyl 2-(6-methyl-1,2,3,4-tetrahydrocarbazol-9-yl)acetate |
|---|---|
| PubChem CID | 658349 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | methyl 2-(6-methyl-1,2,3,4-tetrahydrocarbazol-9-yl)acetate |
| SMILES | COC(=O)Cn1c2c(c3cc(C)ccc31)CCCC2 |
| InChI | InChI=1S/C16H19NO2/c1-11-7-8-15-13(9-11)12-5-3-4-6-14(12)17(15)10-16(18)19-2/h7-9H,3-6,10H2,1-2H3 |
| InChIKey | RKXBPVJQGGGHCO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|