About 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]-1,3-benzoxazole
2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]-1,3-benzoxazole (PubChem CID 658360) has the molecular formula C15H10ClN3OS
and a molecular weight of 315.79 g/mol. Its IUPAC name is 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]-1,3-benzoxazole |
| PubChem CID | 658360 |
| Molecular Formula | C15H10ClN3OS |
| Molecular Weight | 315.79 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]-1,3-benzoxazole |
| SMILES | Clc1ccc2nc(CSc3nc4ccccc4o3)cn2c1 |
| InChI | InChI=1S/C15H10ClN3OS/c16-10-5-6-14-17-11(8-19(14)7-10)9-21-15-18-12-3-1-2-4-13(12)20-15/h1-8H,9H2 |
| InChIKey | ICKUXQKEAADGEY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 43.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.79 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]-1,3-benzoxazole?
The IUPAC name of 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]-1,3-benzoxazole (CID 658360) is 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]-1,3-benzoxazole.
What is the SMILES notation for 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]-1,3-benzoxazole?
The canonical SMILES for 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]-1,3-benzoxazole is Clc1ccc2nc(CSc3nc4ccccc4o3)cn2c1.
What is the InChIKey of 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]-1,3-benzoxazole?
The InChIKey is ICKUXQKEAADGEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClN3OS/c16-10-5-6-14-17-11(8-19(14)7-10)9-21-15-18-12-3-1-2-4-13(12)20-15/h1-8H,9H2.
What are the key properties of 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]-1,3-benzoxazole?
2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]-1,3-benzoxazole has a molecular weight of 315.79 g/mol, XLogP of 4.42, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]-1,3-benzoxazole is sourced from PubChem (CID 658360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).