About 5-methoxy-2-methylthieno[2,3-e][1,3]benzothiazole
5-methoxy-2-methylthieno[2,3-e][1,3]benzothiazole (PubChem CID 658425) has the molecular formula C11H9NOS2
and a molecular weight of 235.33 g/mol. Its IUPAC name is 5-methoxy-2-methylthieno[2,3-e][1,3]benzothiazole.
Molecular Properties
| Compound Name | 5-methoxy-2-methylthieno[2,3-e][1,3]benzothiazole |
| PubChem CID | 658425 |
| Molecular Formula | C11H9NOS2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.01 |
| IUPAC Name | 5-methoxy-2-methylthieno[2,3-e][1,3]benzothiazole |
| SMILES | COc1cc2sc(C)nc2c2sccc12 |
| InChI | InChI=1S/C11H9NOS2/c1-6-12-10-9(15-6)5-8(13-2)7-3-4-14-11(7)10/h3-5H,1-2H3 |
| InChIKey | YDZZWVSGBXQNGF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methoxy-2-methylthieno[2,3-e][1,3]benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2-methylthieno[2,3-e][1,3]benzothiazole?
The IUPAC name of 5-methoxy-2-methylthieno[2,3-e][1,3]benzothiazole (CID 658425) is 5-methoxy-2-methylthieno[2,3-e][1,3]benzothiazole.
What is the SMILES notation for 5-methoxy-2-methylthieno[2,3-e][1,3]benzothiazole?
The canonical SMILES for 5-methoxy-2-methylthieno[2,3-e][1,3]benzothiazole is COc1cc2sc(C)nc2c2sccc12.
What is the InChIKey of 5-methoxy-2-methylthieno[2,3-e][1,3]benzothiazole?
The InChIKey is YDZZWVSGBXQNGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NOS2/c1-6-12-10-9(15-6)5-8(13-2)7-3-4-14-11(7)10/h3-5H,1-2H3.
What are the key properties of 5-methoxy-2-methylthieno[2,3-e][1,3]benzothiazole?
5-methoxy-2-methylthieno[2,3-e][1,3]benzothiazole has a molecular weight of 235.33 g/mol, XLogP of 3.83, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2-methylthieno[2,3-e][1,3]benzothiazole is sourced from PubChem (CID 658425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).