C25H23FN3O+ — CID 6584373
(2R,3R,10bS)-3-(2,2-dimethylpropanoyl)-2-(3-fluorophenyl)-2,3,4,10b-tetrahydropyrrolo[2,1-a]isoquinolin-4-ium-1,1-dicarbonitrile (PubChem CID 6584373) has the molecular formula C25H23FN3O+ and a molecular weight of 400.48 g/mol. Its IUPAC name is (2R,3R,10bS)-3-(2,2-dimethylpropanoyl)-2-(3-fluorophenyl)-2,3,4,10b-tetrahydropyrrolo[2,1-a]isoquinolin-4-ium-1,1-dicarbonitrile.
| Compound Name | (2R,3R,10bS)-3-(2,2-dimethylpropanoyl)-2-(3-fluorophenyl)-2,3,4,10b-tetrahydropyrrolo[2,1-a]isoquinolin-4-ium-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 6584373 |
| Molecular Formula | C25H23FN3O+ |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | (2R,3R,10bS)-3-(2,2-dimethylpropanoyl)-2-(3-fluorophenyl)-2,3,4,10b-tetrahydropyrrolo[2,1-a]isoquinolin-4-ium-1,1-dicarbonitrile |
| SMILES | CC(C)(C)C(=O)[C@H]1[C@H](c2cccc(F)c2)C(C#N)(C#N)[C@@H]2c3ccccc3C=C[NH+]21 |
| InChI | InChI=1S/C25H22FN3O/c1-24(2,3)23(30)21-20(17-8-6-9-18(26)13-17)25(14-27,15-28)22-19-10-5-4-7-16(19)11-12-29(21)22/h4-13,20-22H,1-3H3/p+1/t20-,21+,22-/m0/s1 |
| InChIKey | DGLSJBXQRIXFKY-BDTNDASRSA-O |
| XLogP | 3.55 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |