About 8-(2-hydroxyethylamino)-1-[(4-methoxyphenyl)methyl]-3,7-dimethylpurine-2,6-dione
8-(2-hydroxyethylamino)-1-[(4-methoxyphenyl)methyl]-3,7-dimethylpurine-2,6-dione (PubChem CID 658471) has the molecular formula C17H21N5O4
and a molecular weight of 359.39 g/mol. Its IUPAC name is 8-(2-hydroxyethylamino)-1-[(4-methoxyphenyl)methyl]-3,7-dimethylpurine-2,6-dione.
Molecular Properties
| Compound Name | 8-(2-hydroxyethylamino)-1-[(4-methoxyphenyl)methyl]-3,7-dimethylpurine-2,6-dione |
| PubChem CID | 658471 |
| Molecular Formula | C17H21N5O4 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 8-(2-hydroxyethylamino)-1-[(4-methoxyphenyl)methyl]-3,7-dimethylpurine-2,6-dione |
| SMILES | COc1ccc(Cn2c(=O)c3c(nc(NCCO)n3C)n(C)c2=O)cc1 |
| InChI | InChI=1S/C17H21N5O4/c1-20-13-14(19-16(20)18-8-9-23)21(2)17(25)22(15(13)24)10-11-4-6-12(26-3)7-5-11/h4-7,23H,8-10H2,1-3H3,(H,18,19) |
| InChIKey | AYVHUIZWFJEDAP-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 8-(2-hydroxyethylamino)-1-[(4-methoxyphenyl)methyl]-3,7-dimethylpurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2-hydroxyethylamino)-1-[(4-methoxyphenyl)methyl]-3,7-dimethylpurine-2,6-dione?
The IUPAC name of 8-(2-hydroxyethylamino)-1-[(4-methoxyphenyl)methyl]-3,7-dimethylpurine-2,6-dione (CID 658471) is 8-(2-hydroxyethylamino)-1-[(4-methoxyphenyl)methyl]-3,7-dimethylpurine-2,6-dione.
What is the SMILES notation for 8-(2-hydroxyethylamino)-1-[(4-methoxyphenyl)methyl]-3,7-dimethylpurine-2,6-dione?
The canonical SMILES for 8-(2-hydroxyethylamino)-1-[(4-methoxyphenyl)methyl]-3,7-dimethylpurine-2,6-dione is COc1ccc(Cn2c(=O)c3c(nc(NCCO)n3C)n(C)c2=O)cc1.
What is the InChIKey of 8-(2-hydroxyethylamino)-1-[(4-methoxyphenyl)methyl]-3,7-dimethylpurine-2,6-dione?
The InChIKey is AYVHUIZWFJEDAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N5O4/c1-20-13-14(19-16(20)18-8-9-23)21(2)17(25)22(15(13)24)10-11-4-6-12(26-3)7-5-11/h4-7,23H,8-10H2,1-3H3,(H,18,19).
What are the key properties of 8-(2-hydroxyethylamino)-1-[(4-methoxyphenyl)methyl]-3,7-dimethylpurine-2,6-dione?
8-(2-hydroxyethylamino)-1-[(4-methoxyphenyl)methyl]-3,7-dimethylpurine-2,6-dione has a molecular weight of 359.39 g/mol, XLogP of -0.11, 6 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2-hydroxyethylamino)-1-[(4-methoxyphenyl)methyl]-3,7-dimethylpurine-2,6-dione is sourced from PubChem (CID 658471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).