About prop-2-ynyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate
prop-2-ynyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate (PubChem CID 658539) has the molecular formula C13H15N3O5
and a molecular weight of 293.28 g/mol. Its IUPAC name is prop-2-ynyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate.
Molecular Properties
| Compound Name | prop-2-ynyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate |
| PubChem CID | 658539 |
| Molecular Formula | C13H15N3O5 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | prop-2-ynyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate |
| SMILES | C#CCOC(=O)CCC(=O)Nc1cc(OC)nc(OC)n1 |
| InChI | InChI=1S/C13H15N3O5/c1-4-7-21-12(18)6-5-10(17)14-9-8-11(19-2)16-13(15-9)20-3/h1,8H,5-7H2,2-3H3,(H,14,15,16,17) |
| InChIKey | VJICEYDJXZPLNE-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ynyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ynyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate?
The IUPAC name of prop-2-ynyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate (CID 658539) is prop-2-ynyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate.
What is the SMILES notation for prop-2-ynyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate?
The canonical SMILES for prop-2-ynyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate is C#CCOC(=O)CCC(=O)Nc1cc(OC)nc(OC)n1.
What is the InChIKey of prop-2-ynyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate?
The InChIKey is VJICEYDJXZPLNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O5/c1-4-7-21-12(18)6-5-10(17)14-9-8-11(19-2)16-13(15-9)20-3/h1,8H,5-7H2,2-3H3,(H,14,15,16,17).
What are the key properties of prop-2-ynyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate?
prop-2-ynyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate has a molecular weight of 293.28 g/mol, XLogP of 0.39, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ynyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate is sourced from PubChem (CID 658539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).