C24H41NO2 — CID 6585467
2-[[(1R,2S,6S)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl-[[(1S,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]amino]ethyl acetate (PubChem CID 6585467) has the molecular formula C24H41NO2 and a molecular weight of 375.60 g/mol. Its IUPAC name is 2-[[(1R,2S,6S)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl-[[(1S,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]amino]ethyl acetate.
| Compound Name | 2-[[(1R,2S,6S)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl-[[(1S,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]amino]ethyl acetate |
|---|---|
| PubChem CID | 6585467 |
| Molecular Formula | C24H41NO2 |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 375.31 |
| IUPAC Name | 2-[[(1R,2S,6S)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl-[[(1S,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]amino]ethyl acetate |
| SMILES | CC(=O)OCCN(C[C@H]1[C@H](C)CC(C)=C[C@@H]1C)C[C@H]1[C@@H](C)C=C(C)C[C@@H]1C |
| InChI | InChI=1S/C24H41NO2/c1-16-10-18(3)23(19(4)11-16)14-25(8-9-27-22(7)26)15-24-20(5)12-17(2)13-21(24)6/h10,12,18-21,23-24H,8-9,11,13-15H2,1-7H3/t18-,19-,20-,21+,23-,24+/m0/s1 |
| InChIKey | BRHVDTJVVBPNCJ-PYSZQBSGSA-N |
| XLogP | 5.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|