C26H26N2O4S — CID 6586470
(3R,3aS,6aS)-5-(4-pentoxyphenyl)-2-phenyl-3-thiophen-2-yl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 6586470) has the molecular formula C26H26N2O4S and a molecular weight of 462.57 g/mol. Its IUPAC name is (3R,3aS,6aS)-5-(4-pentoxyphenyl)-2-phenyl-3-thiophen-2-yl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3R,3aS,6aS)-5-(4-pentoxyphenyl)-2-phenyl-3-thiophen-2-yl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 6586470 |
| Molecular Formula | C26H26N2O4S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | (3R,3aS,6aS)-5-(4-pentoxyphenyl)-2-phenyl-3-thiophen-2-yl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | CCCCCOc1ccc(N2C(=O)[C@@H]3[C@H](ON(c4ccccc4)[C@H]3c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C26H26N2O4S/c1-2-3-7-16-31-20-14-12-18(13-15-20)27-25(29)22-23(21-11-8-17-33-21)28(32-24(22)26(27)30)19-9-5-4-6-10-19/h4-6,8-15,17,22-24H,2-3,7,16H2,1H3/t22-,23-,24-/m0/s1 |
| InChIKey | ZJEZDPAHFJVQDT-HJOGWXRNSA-N |
| XLogP | 5.37 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|