C32H35N3O4 — CID 6586587
(3R,3aS,6aS)-3-[4-methoxy-3-[(4-methylpiperidin-1-yl)methyl]phenyl]-5-(4-methylphenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 6586587) has the molecular formula C32H35N3O4 and a molecular weight of 525.65 g/mol. Its IUPAC name is (3R,3aS,6aS)-3-[4-methoxy-3-[(4-methylpiperidin-1-yl)methyl]phenyl]-5-(4-methylphenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3R,3aS,6aS)-3-[4-methoxy-3-[(4-methylpiperidin-1-yl)methyl]phenyl]-5-(4-methylphenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 6586587 |
| Molecular Formula | C32H35N3O4 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | (3R,3aS,6aS)-3-[4-methoxy-3-[(4-methylpiperidin-1-yl)methyl]phenyl]-5-(4-methylphenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | COc1ccc([C@H]2[C@@H]3C(=O)N(c4ccc(C)cc4)C(=O)[C@H]3ON2c2ccccc2)cc1CN1CCC(C)CC1 |
| InChI | InChI=1S/C32H35N3O4/c1-21-9-12-25(13-10-21)34-31(36)28-29(35(39-30(28)32(34)37)26-7-5-4-6-8-26)23-11-14-27(38-3)24(19-23)20-33-17-15-22(2)16-18-33/h4-14,19,22,28-30H,15-18,20H2,1-3H3/t28-,29-,30-/m0/s1 |
| InChIKey | TWXKUKLOLJECQZ-DTXPUJKBSA-N |
| XLogP | 5.29 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|