C17H23N5O — CID 658718
7-methyl-3-morpholin-4-yl-1-(prop-2-enylamino)-6,8-dihydro-5H-2,7-naphthyridine-4-carbonitrile (PubChem CID 658718) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is 7-methyl-3-morpholin-4-yl-1-(prop-2-enylamino)-6,8-dihydro-5H-2,7-naphthyridine-4-carbonitrile.
| Compound Name | 7-methyl-3-morpholin-4-yl-1-(prop-2-enylamino)-6,8-dihydro-5H-2,7-naphthyridine-4-carbonitrile |
|---|---|
| PubChem CID | 658718 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 7-methyl-3-morpholin-4-yl-1-(prop-2-enylamino)-6,8-dihydro-5H-2,7-naphthyridine-4-carbonitrile |
| SMILES | C=CCNc1nc(N2CCOCC2)c(C#N)c2c1CN(C)CC2 |
| InChI | InChI=1S/C17H23N5O/c1-3-5-19-16-15-12-21(2)6-4-13(15)14(11-18)17(20-16)22-7-9-23-10-8-22/h3H,1,4-10,12H2,2H3,(H,19,20) |
| InChIKey | FBBFGAKNXBWOEG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 64.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|