C25H27N5O3 — CID 658802
1,7-dibenzyl-3-methyl-8-(oxolan-2-ylmethylamino)purine-2,6-dione (PubChem CID 658802) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is 1,7-dibenzyl-3-methyl-8-(oxolan-2-ylmethylamino)purine-2,6-dione.
| Compound Name | 1,7-dibenzyl-3-methyl-8-(oxolan-2-ylmethylamino)purine-2,6-dione |
|---|---|
| PubChem CID | 658802 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 1,7-dibenzyl-3-methyl-8-(oxolan-2-ylmethylamino)purine-2,6-dione |
| SMILES | Cn1c(=O)n(Cc2ccccc2)c(=O)c2c1nc(NCC1CCCO1)n2Cc1ccccc1 |
| InChI | InChI=1S/C25H27N5O3/c1-28-22-21(23(31)30(25(28)32)17-19-11-6-3-7-12-19)29(16-18-9-4-2-5-10-18)24(27-22)26-15-20-13-8-14-33-20/h2-7,9-12,20H,8,13-17H2,1H3,(H,26,27) |
| InChIKey | HQLAVNBTTDGILO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |