C18H20N4OS — CID 658838
2-(1,3-benzothiazol-2-yl)-4-(N-cyclopentyl-C-methylcarbonimidoyl)-5-methyl-1H-pyrazol-3-one (PubChem CID 658838) has the molecular formula C18H20N4OS and a molecular weight of 340.45 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-4-(N-cyclopentyl-C-methylcarbonimidoyl)-5-methyl-1H-pyrazol-3-one.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-4-(N-cyclopentyl-C-methylcarbonimidoyl)-5-methyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 658838 |
| Molecular Formula | C18H20N4OS |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-4-(N-cyclopentyl-C-methylcarbonimidoyl)-5-methyl-1H-pyrazol-3-one |
| SMILES | C/C(=N\C1CCCC1)c1c(C)[nH]n(-c2nc3ccccc3s2)c1=O |
| InChI | InChI=1S/C18H20N4OS/c1-11(19-13-7-3-4-8-13)16-12(2)21-22(17(16)23)18-20-14-9-5-6-10-15(14)24-18/h5-6,9-10,13,21H,3-4,7-8H2,1-2H3/b19-11+ |
| InChIKey | USDVXIYQQBUUOD-YBFXNURJSA-N |
| XLogP | 3.84 |
| TPSA | 63.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|