C13H9F4NS — CID 658876
4-[2-(2,3,5,6-tetrafluorophenyl)sulfanylethyl]pyridine (PubChem CID 658876) has the molecular formula C13H9F4NS and a molecular weight of 287.28 g/mol. Its IUPAC name is 4-[2-(2,3,5,6-tetrafluorophenyl)sulfanylethyl]pyridine.
| Compound Name | 4-[2-(2,3,5,6-tetrafluorophenyl)sulfanylethyl]pyridine |
|---|---|
| PubChem CID | 658876 |
| Molecular Formula | C13H9F4NS |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 4-[2-(2,3,5,6-tetrafluorophenyl)sulfanylethyl]pyridine |
| SMILES | Fc1cc(F)c(F)c(SCCc2ccncc2)c1F |
| InChI | InChI=1S/C13H9F4NS/c14-9-7-10(15)12(17)13(11(9)16)19-6-3-8-1-4-18-5-2-8/h1-2,4-5,7H,3,6H2 |
| InChIKey | CLVYSEXRXAITAV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|