About methyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate
methyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate (PubChem CID 658905) has the molecular formula C14H14BrNO5
and a molecular weight of 356.17 g/mol. Its IUPAC name is methyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate |
| PubChem CID | 658905 |
| Molecular Formula | C14H14BrNO5 |
| Molecular Weight | 356.17 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | methyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate |
| SMILES | COC(=O)CN1C(=O)C2(OCCCO2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C14H14BrNO5/c1-19-12(17)8-16-11-4-3-9(15)7-10(11)14(13(16)18)20-5-2-6-21-14/h3-4,7H,2,5-6,8H2,1H3 |
| InChIKey | MOBXWXRBAONHFS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.17 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate?
The IUPAC name of methyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate (CID 658905) is methyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate.
What is the SMILES notation for methyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate?
The canonical SMILES for methyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate is COC(=O)CN1C(=O)C2(OCCCO2)c2cc(Br)ccc21.
What is the InChIKey of methyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate?
The InChIKey is MOBXWXRBAONHFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BrNO5/c1-19-12(17)8-16-11-4-3-9(15)7-10(11)14(13(16)18)20-5-2-6-21-14/h3-4,7H,2,5-6,8H2,1H3.
What are the key properties of methyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate?
methyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate has a molecular weight of 356.17 g/mol, XLogP of 1.56, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate is sourced from PubChem (CID 658905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).