About methyl 3-[[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]-5-methyl-1H-indole-2-carboxylate
methyl 3-[[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]-5-methyl-1H-indole-2-carboxylate (PubChem CID 658948) has the molecular formula C22H23N3O3
and a molecular weight of 377.44 g/mol. Its IUPAC name is methyl 3-[[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]-5-methyl-1H-indole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]-5-methyl-1H-indole-2-carboxylate |
| PubChem CID | 658948 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | methyl 3-[[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]-5-methyl-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2ccc(C)cc2c1NC(=O)CN1CCCc2ccccc21 |
| InChI | InChI=1S/C22H23N3O3/c1-14-9-10-17-16(12-14)20(21(23-17)22(27)28-2)24-19(26)13-25-11-5-7-15-6-3-4-8-18(15)25/h3-4,6,8-10,12,23H,5,7,11,13H2,1-2H3,(H,24,26) |
| InChIKey | CMIYMWHBLLWGMK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-[[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]-5-methyl-1H-indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]-5-methyl-1H-indole-2-carboxylate?
The IUPAC name of methyl 3-[[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]-5-methyl-1H-indole-2-carboxylate (CID 658948) is methyl 3-[[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]-5-methyl-1H-indole-2-carboxylate.
What is the SMILES notation for methyl 3-[[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]-5-methyl-1H-indole-2-carboxylate?
The canonical SMILES for methyl 3-[[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]-5-methyl-1H-indole-2-carboxylate is COC(=O)c1[nH]c2ccc(C)cc2c1NC(=O)CN1CCCc2ccccc21.
What is the InChIKey of methyl 3-[[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]-5-methyl-1H-indole-2-carboxylate?
The InChIKey is CMIYMWHBLLWGMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N3O3/c1-14-9-10-17-16(12-14)20(21(23-17)22(27)28-2)24-19(26)13-25-11-5-7-15-6-3-4-8-18(15)25/h3-4,6,8-10,12,23H,5,7,11,13H2,1-2H3,(H,24,26).
What are the key properties of methyl 3-[[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]-5-methyl-1H-indole-2-carboxylate?
methyl 3-[[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]-5-methyl-1H-indole-2-carboxylate has a molecular weight of 377.44 g/mol, XLogP of 3.65, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]-5-methyl-1H-indole-2-carboxylate is sourced from PubChem (CID 658948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).