C9H8F6N2OS — CID 658974
N-(1,3-thiazol-2-yl)-2,2-bis(trifluoromethyl)butanamide (PubChem CID 658974) has the molecular formula C9H8F6N2OS and a molecular weight of 306.23 g/mol. Its IUPAC name is N-(1,3-thiazol-2-yl)-2,2-bis(trifluoromethyl)butanamide.
| Compound Name | N-(1,3-thiazol-2-yl)-2,2-bis(trifluoromethyl)butanamide |
|---|---|
| PubChem CID | 658974 |
| Molecular Formula | C9H8F6N2OS |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | N-(1,3-thiazol-2-yl)-2,2-bis(trifluoromethyl)butanamide |
| SMILES | CCC(C(=O)Nc1nccs1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H8F6N2OS/c1-2-7(8(10,11)12,9(13,14)15)5(18)17-6-16-3-4-19-6/h3-4H,2H2,1H3,(H,16,17,18) |
| InChIKey | LMRNYPTZODFOFJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |