About N-(4-oxo-1,3-benzothiazin-2-yl)benzamide
N-(4-oxo-1,3-benzothiazin-2-yl)benzamide (PubChem CID 658982) has the molecular formula C15H10N2O2S
and a molecular weight of 282.32 g/mol. Its IUPAC name is N-(4-oxo-1,3-benzothiazin-2-yl)benzamide.
Molecular Properties
| Compound Name | N-(4-oxo-1,3-benzothiazin-2-yl)benzamide |
| PubChem CID | 658982 |
| Molecular Formula | C15H10N2O2S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | N-(4-oxo-1,3-benzothiazin-2-yl)benzamide |
| SMILES | O=C(Nc1nc(=O)c2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C15H10N2O2S/c18-13(10-6-2-1-3-7-10)16-15-17-14(19)11-8-4-5-9-12(11)20-15/h1-9H,(H,16,17,18,19) |
| InChIKey | QUQMZOJJCAYNOI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-oxo-1,3-benzothiazin-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-oxo-1,3-benzothiazin-2-yl)benzamide?
The IUPAC name of N-(4-oxo-1,3-benzothiazin-2-yl)benzamide (CID 658982) is N-(4-oxo-1,3-benzothiazin-2-yl)benzamide.
What is the SMILES notation for N-(4-oxo-1,3-benzothiazin-2-yl)benzamide?
The canonical SMILES for N-(4-oxo-1,3-benzothiazin-2-yl)benzamide is O=C(Nc1nc(=O)c2ccccc2s1)c1ccccc1.
What is the InChIKey of N-(4-oxo-1,3-benzothiazin-2-yl)benzamide?
The InChIKey is QUQMZOJJCAYNOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2O2S/c18-13(10-6-2-1-3-7-10)16-15-17-14(19)11-8-4-5-9-12(11)20-15/h1-9H,(H,16,17,18,19).
What are the key properties of N-(4-oxo-1,3-benzothiazin-2-yl)benzamide?
N-(4-oxo-1,3-benzothiazin-2-yl)benzamide has a molecular weight of 282.32 g/mol, XLogP of 2.91, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-oxo-1,3-benzothiazin-2-yl)benzamide is sourced from PubChem (CID 658982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).