C19H25N5O4 — CID 658993
3-[[N-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]-4-methylanilino]methyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 658993) has the molecular formula C19H25N5O4 and a molecular weight of 387.44 g/mol. Its IUPAC name is 3-[[N-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]-4-methylanilino]methyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[[N-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]-4-methylanilino]methyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 658993 |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 3-[[N-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]-4-methylanilino]methyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | Cc1ccc(N(CN2C(=O)NC(C)(C)C2=O)CN2C(=O)NC(C)(C)C2=O)cc1 |
| InChI | InChI=1S/C19H25N5O4/c1-12-6-8-13(9-7-12)22(10-23-14(25)18(2,3)20-16(23)27)11-24-15(26)19(4,5)21-17(24)28/h6-9H,10-11H2,1-5H3,(H,20,27)(H,21,28) |
| InChIKey | GTYRCRCIBAEAEP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|