About 6-benzyl-3-sulfanylidene-2H-1,2,4-triazin-5-one
6-benzyl-3-sulfanylidene-2H-1,2,4-triazin-5-one (PubChem CID 659040) has the molecular formula C10H9N3OS
and a molecular weight of 219.27 g/mol. Its IUPAC name is 6-benzyl-3-sulfanylidene-2H-1,2,4-triazin-5-one.
Molecular Properties
| Compound Name | 6-benzyl-3-sulfanylidene-2H-1,2,4-triazin-5-one |
| PubChem CID | 659040 |
| Molecular Formula | C10H9N3OS |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 6-benzyl-3-sulfanylidene-2H-1,2,4-triazin-5-one |
| SMILES | O=c1[nH]c(=S)[nH]nc1Cc1ccccc1 |
| InChI | InChI=1S/C10H9N3OS/c14-9-8(12-13-10(15)11-9)6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,11,13,14,15) |
| InChIKey | FVLMRSJALFJPOF-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-benzyl-3-sulfanylidene-2H-1,2,4-triazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzyl-3-sulfanylidene-2H-1,2,4-triazin-5-one?
The IUPAC name of 6-benzyl-3-sulfanylidene-2H-1,2,4-triazin-5-one (CID 659040) is 6-benzyl-3-sulfanylidene-2H-1,2,4-triazin-5-one.
What is the SMILES notation for 6-benzyl-3-sulfanylidene-2H-1,2,4-triazin-5-one?
The canonical SMILES for 6-benzyl-3-sulfanylidene-2H-1,2,4-triazin-5-one is O=c1[nH]c(=S)[nH]nc1Cc1ccccc1.
What is the InChIKey of 6-benzyl-3-sulfanylidene-2H-1,2,4-triazin-5-one?
The InChIKey is FVLMRSJALFJPOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3OS/c14-9-8(12-13-10(15)11-9)6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,11,13,14,15).
What are the key properties of 6-benzyl-3-sulfanylidene-2H-1,2,4-triazin-5-one?
6-benzyl-3-sulfanylidene-2H-1,2,4-triazin-5-one has a molecular weight of 219.27 g/mol, XLogP of 1.42, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzyl-3-sulfanylidene-2H-1,2,4-triazin-5-one is sourced from PubChem (CID 659040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).