About 2,4-diamino-6-propylpyridine-3,5-dicarbonitrile
2,4-diamino-6-propylpyridine-3,5-dicarbonitrile (PubChem CID 659074) has the molecular formula C10H11N5
and a molecular weight of 201.23 g/mol. Its IUPAC name is 2,4-diamino-6-propylpyridine-3,5-dicarbonitrile.
Molecular Properties
| Compound Name | 2,4-diamino-6-propylpyridine-3,5-dicarbonitrile |
| PubChem CID | 659074 |
| Molecular Formula | C10H11N5 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 2,4-diamino-6-propylpyridine-3,5-dicarbonitrile |
| SMILES | CCCc1nc(N)c(C#N)c(N)c1C#N |
| InChI | InChI=1S/C10H11N5/c1-2-3-8-6(4-11)9(13)7(5-12)10(14)15-8/h2-3H2,1H3,(H4,13,14,15) |
| InChIKey | YYPYUXPAQYOLFA-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 112.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,4-diamino-6-propylpyridine-3,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diamino-6-propylpyridine-3,5-dicarbonitrile?
The IUPAC name of 2,4-diamino-6-propylpyridine-3,5-dicarbonitrile (CID 659074) is 2,4-diamino-6-propylpyridine-3,5-dicarbonitrile.
What is the SMILES notation for 2,4-diamino-6-propylpyridine-3,5-dicarbonitrile?
The canonical SMILES for 2,4-diamino-6-propylpyridine-3,5-dicarbonitrile is CCCc1nc(N)c(C#N)c(N)c1C#N.
What is the InChIKey of 2,4-diamino-6-propylpyridine-3,5-dicarbonitrile?
The InChIKey is YYPYUXPAQYOLFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N5/c1-2-3-8-6(4-11)9(13)7(5-12)10(14)15-8/h2-3H2,1H3,(H4,13,14,15).
What are the key properties of 2,4-diamino-6-propylpyridine-3,5-dicarbonitrile?
2,4-diamino-6-propylpyridine-3,5-dicarbonitrile has a molecular weight of 201.23 g/mol, XLogP of 0.94, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diamino-6-propylpyridine-3,5-dicarbonitrile is sourced from PubChem (CID 659074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).