C21H23N3O3S — CID 6591001
(3aS,7aS)-2-[(2S)-1-(2-benzylimino-1,3-thiazolidin-3-yl)-1-oxopropan-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 6591001) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is (3aS,7aS)-2-[(2S)-1-(2-benzylimino-1,3-thiazolidin-3-yl)-1-oxopropan-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aS)-2-[(2S)-1-(2-benzylimino-1,3-thiazolidin-3-yl)-1-oxopropan-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 6591001 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | (3aS,7aS)-2-[(2S)-1-(2-benzylimino-1,3-thiazolidin-3-yl)-1-oxopropan-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | C[C@@H](C(=O)N1CCS/C1=N\Cc1ccccc1)N1C(=O)[C@H]2CC=CC[C@@H]2C1=O |
| InChI | InChI=1S/C21H23N3O3S/c1-14(24-19(26)16-9-5-6-10-17(16)20(24)27)18(25)23-11-12-28-21(23)22-13-15-7-3-2-4-8-15/h2-8,14,16-17H,9-13H2,1H3/b22-21-/t14-,16-,17-/m0/s1 |
| InChIKey | CTUKWRGEDLDAAD-BRZXZVMOSA-N |
| XLogP | 2.46 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|