About 6,10-dimethyl-N-(2-piperazin-1-ylethyl)undeca-5,9-dien-2-amine
6,10-dimethyl-N-(2-piperazin-1-ylethyl)undeca-5,9-dien-2-amine (PubChem CID 659118) has the molecular formula C19H37N3
and a molecular weight of 307.53 g/mol. Its IUPAC name is 6,10-dimethyl-N-(2-piperazin-1-ylethyl)undeca-5,9-dien-2-amine.
Molecular Properties
| Compound Name | 6,10-dimethyl-N-(2-piperazin-1-ylethyl)undeca-5,9-dien-2-amine |
| PubChem CID | 659118 |
| Molecular Formula | C19H37N3 |
| Molecular Weight | 307.53 g/mol |
| Exact Mass | 307.30 |
| IUPAC Name | 6,10-dimethyl-N-(2-piperazin-1-ylethyl)undeca-5,9-dien-2-amine |
| SMILES | CC(C)=CCCC(C)=CCCC(C)NCCN1CCNCC1 |
| InChI | InChI=1S/C19H37N3/c1-17(2)7-5-8-18(3)9-6-10-19(4)21-13-16-22-14-11-20-12-15-22/h7,9,19-21H,5-6,8,10-16H2,1-4H3 |
| InChIKey | UDVLXVKLNWJVCX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6,10-dimethyl-N-(2-piperazin-1-ylethyl)undeca-5,9-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,10-dimethyl-N-(2-piperazin-1-ylethyl)undeca-5,9-dien-2-amine?
The IUPAC name of 6,10-dimethyl-N-(2-piperazin-1-ylethyl)undeca-5,9-dien-2-amine (CID 659118) is 6,10-dimethyl-N-(2-piperazin-1-ylethyl)undeca-5,9-dien-2-amine.
What is the SMILES notation for 6,10-dimethyl-N-(2-piperazin-1-ylethyl)undeca-5,9-dien-2-amine?
The canonical SMILES for 6,10-dimethyl-N-(2-piperazin-1-ylethyl)undeca-5,9-dien-2-amine is CC(C)=CCCC(C)=CCCC(C)NCCN1CCNCC1.
What is the InChIKey of 6,10-dimethyl-N-(2-piperazin-1-ylethyl)undeca-5,9-dien-2-amine?
The InChIKey is UDVLXVKLNWJVCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H37N3/c1-17(2)7-5-8-18(3)9-6-10-19(4)21-13-16-22-14-11-20-12-15-22/h7,9,19-21H,5-6,8,10-16H2,1-4H3.
What are the key properties of 6,10-dimethyl-N-(2-piperazin-1-ylethyl)undeca-5,9-dien-2-amine?
6,10-dimethyl-N-(2-piperazin-1-ylethyl)undeca-5,9-dien-2-amine has a molecular weight of 307.53 g/mol, XLogP of 3.34, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,10-dimethyl-N-(2-piperazin-1-ylethyl)undeca-5,9-dien-2-amine is sourced from PubChem (CID 659118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).