C11H19ClN2O2 — CID 6591476
2-chloro-N-[[(1S,2R,3S)-2,3-dimethylcyclohexyl]carbamoyl]acetamide (PubChem CID 6591476) has the molecular formula C11H19ClN2O2 and a molecular weight of 246.74 g/mol. Its IUPAC name is 2-chloro-N-[[(1S,2R,3S)-2,3-dimethylcyclohexyl]carbamoyl]acetamide.
| Compound Name | 2-chloro-N-[[(1S,2R,3S)-2,3-dimethylcyclohexyl]carbamoyl]acetamide |
|---|---|
| PubChem CID | 6591476 |
| Molecular Formula | C11H19ClN2O2 |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 2-chloro-N-[[(1S,2R,3S)-2,3-dimethylcyclohexyl]carbamoyl]acetamide |
| SMILES | C[C@H]1[C@@H](NC(=O)NC(=O)CCl)CCC[C@@H]1C |
| InChI | InChI=1S/C11H19ClN2O2/c1-7-4-3-5-9(8(7)2)13-11(16)14-10(15)6-12/h7-9H,3-6H2,1-2H3,(H2,13,14,15,16)/t7-,8+,9-/m0/s1 |
| InChIKey | HMBFDDSLYMRBIX-YIZRAAEISA-N |
| XLogP | 1.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|