C18H21N5O4S2 — CID 6591964
2-(N-[(3aS,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]-4-methoxyanilino)-N-(5-methyl-1H-pyrazol-3-yl)acetamide (PubChem CID 6591964) has the molecular formula C18H21N5O4S2 and a molecular weight of 435.53 g/mol. Its IUPAC name is 2-(N-[(3aS,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]-4-methoxyanilino)-N-(5-methyl-1H-pyrazol-3-yl)acetamide.
| Compound Name | 2-(N-[(3aS,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]-4-methoxyanilino)-N-(5-methyl-1H-pyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 6591964 |
| Molecular Formula | C18H21N5O4S2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 2-(N-[(3aS,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]-4-methoxyanilino)-N-(5-methyl-1H-pyrazol-3-yl)acetamide |
| SMILES | COc1ccc(N(CC(=O)Nc2cc(C)[nH]n2)C2=N[C@H]3CS(=O)(=O)C[C@@H]3S2)cc1 |
| InChI | InChI=1S/C18H21N5O4S2/c1-11-7-16(22-21-11)20-17(24)8-23(12-3-5-13(27-2)6-4-12)18-19-14-9-29(25,26)10-15(14)28-18/h3-7,14-15H,8-10H2,1-2H3,(H2,20,21,22,24)/t14-,15-/m0/s1 |
| InChIKey | CXAXBRYHAGDYLN-GJZGRUSLSA-N |
| XLogP | 1.44 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |