C20H21ClN2O2S2 — CID 6592100
(3aS,6aR)-N-[(4-chlorophenyl)methyl]-N-(4-ethylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-amine (PubChem CID 6592100) has the molecular formula C20H21ClN2O2S2 and a molecular weight of 420.99 g/mol. Its IUPAC name is (3aS,6aR)-N-[(4-chlorophenyl)methyl]-N-(4-ethylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-amine.
| Compound Name | (3aS,6aR)-N-[(4-chlorophenyl)methyl]-N-(4-ethylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-amine |
|---|---|
| PubChem CID | 6592100 |
| Molecular Formula | C20H21ClN2O2S2 |
| Molecular Weight | 420.99 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | (3aS,6aR)-N-[(4-chlorophenyl)methyl]-N-(4-ethylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-amine |
| SMILES | CCc1ccc(N(Cc2ccc(Cl)cc2)C2=N[C@H]3CS(=O)(=O)C[C@@H]3S2)cc1 |
| InChI | InChI=1S/C20H21ClN2O2S2/c1-2-14-5-9-17(10-6-14)23(11-15-3-7-16(21)8-4-15)20-22-18-12-27(24,25)13-19(18)26-20/h3-10,18-19H,2,11-13H2,1H3/t18-,19-/m0/s1 |
| InChIKey | CFGXNVAJPFAIDU-OALUTQOASA-N |
| XLogP | 4.18 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.99 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |