About N-acetyl-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide
N-acetyl-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide (PubChem CID 659357) has the molecular formula C18H25NO4
and a molecular weight of 319.40 g/mol. Its IUPAC name is N-acetyl-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide.
Molecular Properties
| Compound Name | N-acetyl-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide |
| PubChem CID | 659357 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | N-acetyl-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide |
| SMILES | COc1ccc(C2(CN(C(C)=O)C(C)=O)CCCC2)cc1OC |
| InChI | InChI=1S/C18H25NO4/c1-13(20)19(14(2)21)12-18(9-5-6-10-18)15-7-8-16(22-3)17(11-15)23-4/h7-8,11H,5-6,9-10,12H2,1-4H3 |
| InChIKey | UGNGHBMXNUTKIO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-acetyl-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acetyl-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide?
The IUPAC name of N-acetyl-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide (CID 659357) is N-acetyl-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide.
What is the SMILES notation for N-acetyl-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide?
The canonical SMILES for N-acetyl-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide is COc1ccc(C2(CN(C(C)=O)C(C)=O)CCCC2)cc1OC.
What is the InChIKey of N-acetyl-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide?
The InChIKey is UGNGHBMXNUTKIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO4/c1-13(20)19(14(2)21)12-18(9-5-6-10-18)15-7-8-16(22-3)17(11-15)23-4/h7-8,11H,5-6,9-10,12H2,1-4H3.
What are the key properties of N-acetyl-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide?
N-acetyl-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide has a molecular weight of 319.40 g/mol, XLogP of 2.91, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-acetyl-N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]acetamide is sourced from PubChem (CID 659357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).