About ethyl 2-(9-imino-2,3-dihydro-1H-cyclopenta[b]quinolin-4-yl)acetate
ethyl 2-(9-imino-2,3-dihydro-1H-cyclopenta[b]quinolin-4-yl)acetate (PubChem CID 659379) has the molecular formula C16H18N2O2
and a molecular weight of 270.33 g/mol. Its IUPAC name is ethyl 2-(9-imino-2,3-dihydro-1H-cyclopenta[b]quinolin-4-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(9-imino-2,3-dihydro-1H-cyclopenta[b]quinolin-4-yl)acetate |
| PubChem CID | 659379 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | ethyl 2-(9-imino-2,3-dihydro-1H-cyclopenta[b]quinolin-4-yl)acetate |
| SMILES | [H]/N=c1\c2c(n(CC(=O)OCC)c3ccccc13)CCC2 |
| InChI | InChI=1S/C16H18N2O2/c1-2-20-15(19)10-18-13-8-4-3-6-11(13)16(17)12-7-5-9-14(12)18/h3-4,6,8,17H,2,5,7,9-10H2,1H3/b17-16- |
| InChIKey | RQFIOVVJDCQWCB-MSUUIHNZSA-N |
| XLogP | 2.17 |
| TPSA | 55.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-(9-imino-2,3-dihydro-1H-cyclopenta[b]quinolin-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(9-imino-2,3-dihydro-1H-cyclopenta[b]quinolin-4-yl)acetate?
The IUPAC name of ethyl 2-(9-imino-2,3-dihydro-1H-cyclopenta[b]quinolin-4-yl)acetate (CID 659379) is ethyl 2-(9-imino-2,3-dihydro-1H-cyclopenta[b]quinolin-4-yl)acetate.
What is the SMILES notation for ethyl 2-(9-imino-2,3-dihydro-1H-cyclopenta[b]quinolin-4-yl)acetate?
The canonical SMILES for ethyl 2-(9-imino-2,3-dihydro-1H-cyclopenta[b]quinolin-4-yl)acetate is [H]/N=c1\c2c(n(CC(=O)OCC)c3ccccc13)CCC2.
What is the InChIKey of ethyl 2-(9-imino-2,3-dihydro-1H-cyclopenta[b]quinolin-4-yl)acetate?
The InChIKey is RQFIOVVJDCQWCB-MSUUIHNZSA-N. The full InChI is InChI=1S/C16H18N2O2/c1-2-20-15(19)10-18-13-8-4-3-6-11(13)16(17)12-7-5-9-14(12)18/h3-4,6,8,17H,2,5,7,9-10H2,1H3/b17-16-.
What are the key properties of ethyl 2-(9-imino-2,3-dihydro-1H-cyclopenta[b]quinolin-4-yl)acetate?
ethyl 2-(9-imino-2,3-dihydro-1H-cyclopenta[b]quinolin-4-yl)acetate has a molecular weight of 270.33 g/mol, XLogP of 2.17, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(9-imino-2,3-dihydro-1H-cyclopenta[b]quinolin-4-yl)acetate is sourced from PubChem (CID 659379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).