About 8-(ethylamino)-7-hexyl-1,3-dimethylpurine-2,6-dione
8-(ethylamino)-7-hexyl-1,3-dimethylpurine-2,6-dione (PubChem CID 659424) has the molecular formula C15H25N5O2
and a molecular weight of 307.40 g/mol. Its IUPAC name is 8-(ethylamino)-7-hexyl-1,3-dimethylpurine-2,6-dione.
Molecular Properties
| Compound Name | 8-(ethylamino)-7-hexyl-1,3-dimethylpurine-2,6-dione |
| PubChem CID | 659424 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 8-(ethylamino)-7-hexyl-1,3-dimethylpurine-2,6-dione |
| SMILES | CCCCCCn1c(NCC)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C15H25N5O2/c1-5-7-8-9-10-20-11-12(17-14(20)16-6-2)18(3)15(22)19(4)13(11)21/h5-10H2,1-4H3,(H,16,17) |
| InChIKey | MPDUJQDXXINYBS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-(ethylamino)-7-hexyl-1,3-dimethylpurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(ethylamino)-7-hexyl-1,3-dimethylpurine-2,6-dione?
The IUPAC name of 8-(ethylamino)-7-hexyl-1,3-dimethylpurine-2,6-dione (CID 659424) is 8-(ethylamino)-7-hexyl-1,3-dimethylpurine-2,6-dione.
What is the SMILES notation for 8-(ethylamino)-7-hexyl-1,3-dimethylpurine-2,6-dione?
The canonical SMILES for 8-(ethylamino)-7-hexyl-1,3-dimethylpurine-2,6-dione is CCCCCCn1c(NCC)nc2c1c(=O)n(C)c(=O)n2C.
What is the InChIKey of 8-(ethylamino)-7-hexyl-1,3-dimethylpurine-2,6-dione?
The InChIKey is MPDUJQDXXINYBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N5O2/c1-5-7-8-9-10-20-11-12(17-14(20)16-6-2)18(3)15(22)19(4)13(11)21/h5-10H2,1-4H3,(H,16,17).
What are the key properties of 8-(ethylamino)-7-hexyl-1,3-dimethylpurine-2,6-dione?
8-(ethylamino)-7-hexyl-1,3-dimethylpurine-2,6-dione has a molecular weight of 307.40 g/mol, XLogP of 1.45, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(ethylamino)-7-hexyl-1,3-dimethylpurine-2,6-dione is sourced from PubChem (CID 659424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).