C14H12N4O3S — CID 659438
2-(1,3-dioxoisoindol-2-yl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 659438) has the molecular formula C14H12N4O3S and a molecular weight of 316.34 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 659438 |
| Molecular Formula | C14H12N4O3S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCc1nnc(NC(=O)CN2C(=O)c3ccccc3C2=O)s1 |
| InChI | InChI=1S/C14H12N4O3S/c1-2-11-16-17-14(22-11)15-10(19)7-18-12(20)8-5-3-4-6-9(8)13(18)21/h3-6H,2,7H2,1H3,(H,15,17,19) |
| InChIKey | GOSBIMRHNIGHFK-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|