C22H27NO3 — CID 659481
3,3,6,6-tetramethyl-9-(5-methylfuran-2-yl)-2,4,5,7,9,10-hexahydroacridine-1,8-dione (PubChem CID 659481) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is 3,3,6,6-tetramethyl-9-(5-methylfuran-2-yl)-2,4,5,7,9,10-hexahydroacridine-1,8-dione.
| Compound Name | 3,3,6,6-tetramethyl-9-(5-methylfuran-2-yl)-2,4,5,7,9,10-hexahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 659481 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 3,3,6,6-tetramethyl-9-(5-methylfuran-2-yl)-2,4,5,7,9,10-hexahydroacridine-1,8-dione |
| SMILES | Cc1ccc(C2C3=C(CC(C)(C)CC3=O)NC3=C2C(=O)CC(C)(C)C3)o1 |
| InChI | InChI=1S/C22H27NO3/c1-12-6-7-17(26-12)20-18-13(8-21(2,3)10-15(18)24)23-14-9-22(4,5)11-16(25)19(14)20/h6-7,20,23H,8-11H2,1-5H3 |
| InChIKey | KHBVCBKZENBHCZ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |