C22H27NO4 — CID 659511
2-[(4,4-dimethyl-2,6-dioxocyclohexyl)-pyridin-4-ylmethyl]-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 659511) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is 2-[(4,4-dimethyl-2,6-dioxocyclohexyl)-pyridin-4-ylmethyl]-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-[(4,4-dimethyl-2,6-dioxocyclohexyl)-pyridin-4-ylmethyl]-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 659511 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 2-[(4,4-dimethyl-2,6-dioxocyclohexyl)-pyridin-4-ylmethyl]-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CC1(C)CC(=O)C(C(c2ccncc2)C2C(=O)CC(C)(C)CC2=O)C(=O)C1 |
| InChI | InChI=1S/C22H27NO4/c1-21(2)9-14(24)19(15(25)10-21)18(13-5-7-23-8-6-13)20-16(26)11-22(3,4)12-17(20)27/h5-8,18-20H,9-12H2,1-4H3 |
| InChIKey | LXZJGNIPNJOEGX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 81.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|