C18H23N5O4 — CID 659538
8-[2-(3,4-dimethoxyphenyl)ethylamino]-1,3,7-trimethylpurine-2,6-dione (PubChem CID 659538) has the molecular formula C18H23N5O4 and a molecular weight of 373.41 g/mol. Its IUPAC name is 8-[2-(3,4-dimethoxyphenyl)ethylamino]-1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 8-[2-(3,4-dimethoxyphenyl)ethylamino]-1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 659538 |
| Molecular Formula | C18H23N5O4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 8-[2-(3,4-dimethoxyphenyl)ethylamino]-1,3,7-trimethylpurine-2,6-dione |
| SMILES | COc1ccc(CCNc2nc3c(c(=O)n(C)c(=O)n3C)n2C)cc1OC |
| InChI | InChI=1S/C18H23N5O4/c1-21-14-15(22(2)18(25)23(3)16(14)24)20-17(21)19-9-8-11-6-7-12(26-4)13(10-11)27-5/h6-7,10H,8-9H2,1-5H3,(H,19,20) |
| InChIKey | NWACSLCEDWODTA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |