C31H30O2P2 — CID 6595843
(1S,2S,3S,4S)-2,3-bis(diphenylphosphoryl)bicyclo[2.2.1]heptane (PubChem CID 6595843) has the molecular formula C31H30O2P2 and a molecular weight of 496.53 g/mol. Its IUPAC name is (1S,2S,3S,4S)-2,3-bis(diphenylphosphoryl)bicyclo[2.2.1]heptane.
| Compound Name | (1S,2S,3S,4S)-2,3-bis(diphenylphosphoryl)bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 6595843 |
| Molecular Formula | C31H30O2P2 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | (1S,2S,3S,4S)-2,3-bis(diphenylphosphoryl)bicyclo[2.2.1]heptane |
| SMILES | O=P(c1ccccc1)(c1ccccc1)[C@H]1[C@H]2CC[C@@H](C2)[C@@H]1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H30O2P2/c32-34(26-13-5-1-6-14-26,27-15-7-2-8-16-27)30-24-21-22-25(23-24)31(30)35(33,28-17-9-3-10-18-28)29-19-11-4-12-20-29/h1-20,24-25,30-31H,21-23H2/t24-,25-,30-,31-/m0/s1 |
| InChIKey | QFKSDBYGNQVKML-FRGOEROOSA-N |
| XLogP | 6.18 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|