C12H16F6N4O — CID 659593
1-(3-imidazol-1-ylpropyl)-3-[1,1,1-trifluoro-2-(trifluoromethyl)butan-2-yl]urea (PubChem CID 659593) has the molecular formula C12H16F6N4O and a molecular weight of 346.28 g/mol. Its IUPAC name is 1-(3-imidazol-1-ylpropyl)-3-[1,1,1-trifluoro-2-(trifluoromethyl)butan-2-yl]urea.
| Compound Name | 1-(3-imidazol-1-ylpropyl)-3-[1,1,1-trifluoro-2-(trifluoromethyl)butan-2-yl]urea |
|---|---|
| PubChem CID | 659593 |
| Molecular Formula | C12H16F6N4O |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 1-(3-imidazol-1-ylpropyl)-3-[1,1,1-trifluoro-2-(trifluoromethyl)butan-2-yl]urea |
| SMILES | CCC(NC(=O)NCCCn1ccnc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H16F6N4O/c1-2-10(11(13,14)15,12(16,17)18)21-9(23)20-4-3-6-22-7-5-19-8-22/h5,7-8H,2-4,6H2,1H3,(H2,20,21,23) |
| InChIKey | UYRFUTPQASBVTJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|