C18H21F3N4O — CID 659612
N-butyl-5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 659612) has the molecular formula C18H21F3N4O and a molecular weight of 366.39 g/mol. Its IUPAC name is N-butyl-5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-butyl-5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 659612 |
| Molecular Formula | C18H21F3N4O |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | N-butyl-5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | CCCCNC(=O)c1cc2n(n1)C(C(F)(F)F)CC(c1ccccc1)N2 |
| InChI | InChI=1S/C18H21F3N4O/c1-2-3-9-22-17(26)14-11-16-23-13(12-7-5-4-6-8-12)10-15(18(19,20)21)25(16)24-14/h4-8,11,13,15,23H,2-3,9-10H2,1H3,(H,22,26) |
| InChIKey | FUPYVWBFPLDBKE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|