C20H23N5O4 — CID 659631
1-butyl-5-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminomethyl]-6-hydroxypyrimidine-2,4-dione (PubChem CID 659631) has the molecular formula C20H23N5O4 and a molecular weight of 397.44 g/mol. Its IUPAC name is 1-butyl-5-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminomethyl]-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-butyl-5-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminomethyl]-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 659631 |
| Molecular Formula | C20H23N5O4 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 1-butyl-5-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminomethyl]-6-hydroxypyrimidine-2,4-dione |
| SMILES | CCCCn1c(O)c(/C=N/c2c(C)n(C)n(-c3ccccc3)c2=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H23N5O4/c1-4-5-11-24-18(27)15(17(26)22-20(24)29)12-21-16-13(2)23(3)25(19(16)28)14-9-7-6-8-10-14/h6-10,12,27H,4-5,11H2,1-3H3,(H,22,26,29)/b21-12+ |
| InChIKey | LADDCMKXUAURHP-CIAFOILYSA-N |
| XLogP | 1.59 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|