C21H26ClN2O+ — CID 6596514
(2S,9aR)-2-(4-chlorophenyl)-1-(4-methylphenyl)-3,4,5,6,7,8,9,9a-octahydroimidazo[1,2-a]azepin-4-ium-2-ol (PubChem CID 6596514) has the molecular formula C21H26ClN2O+ and a molecular weight of 357.91 g/mol. Its IUPAC name is (2S,9aR)-2-(4-chlorophenyl)-1-(4-methylphenyl)-3,4,5,6,7,8,9,9a-octahydroimidazo[1,2-a]azepin-4-ium-2-ol.
| Compound Name | (2S,9aR)-2-(4-chlorophenyl)-1-(4-methylphenyl)-3,4,5,6,7,8,9,9a-octahydroimidazo[1,2-a]azepin-4-ium-2-ol |
|---|---|
| PubChem CID | 6596514 |
| Molecular Formula | C21H26ClN2O+ |
| Molecular Weight | 357.91 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | (2S,9aR)-2-(4-chlorophenyl)-1-(4-methylphenyl)-3,4,5,6,7,8,9,9a-octahydroimidazo[1,2-a]azepin-4-ium-2-ol |
| SMILES | Cc1ccc(N2[C@H]3CCCCC[NH+]3C[C@@]2(O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H25ClN2O/c1-16-6-12-19(13-7-16)24-20-5-3-2-4-14-23(20)15-21(24,25)17-8-10-18(22)11-9-17/h6-13,20,25H,2-5,14-15H2,1H3/p+1/t20-,21+/m0/s1 |
| InChIKey | QKBJYJLZSLIWFC-LEWJYISDSA-O |
| XLogP | 3.10 |
| TPSA | 27.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.91 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |