C25H31N3O4 — CID 659657
2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-1-(5-methoxy-1,2-dimethylindol-3-yl)ethanol (PubChem CID 659657) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-1-(5-methoxy-1,2-dimethylindol-3-yl)ethanol.
| Compound Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-1-(5-methoxy-1,2-dimethylindol-3-yl)ethanol |
|---|---|
| PubChem CID | 659657 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-1-(5-methoxy-1,2-dimethylindol-3-yl)ethanol |
| SMILES | COc1ccc2c(c1)c(C(O)CN1CCN(Cc3ccc4c(c3)OCO4)CC1)c(C)n2C |
| InChI | InChI=1S/C25H31N3O4/c1-17-25(20-13-19(30-3)5-6-21(20)26(17)2)22(29)15-28-10-8-27(9-11-28)14-18-4-7-23-24(12-18)32-16-31-23/h4-7,12-13,22,29H,8-11,14-16H2,1-3H3 |
| InChIKey | XLKWSSIQDSIUTH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 59.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|