C7H5F6N3OS — CID 659677
1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-(1,3-thiazol-2-yl)urea (PubChem CID 659677) has the molecular formula C7H5F6N3OS and a molecular weight of 293.19 g/mol. Its IUPAC name is 1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 659677 |
| Molecular Formula | C7H5F6N3OS |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-(1,3-thiazol-2-yl)urea |
| SMILES | O=C(Nc1nccs1)NC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H5F6N3OS/c8-6(9,10)3(7(11,12)13)15-4(17)16-5-14-1-2-18-5/h1-3H,(H2,14,15,16,17) |
| InChIKey | JFDMPQPKSFNCMK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |