About 5-(diethylamino)-N,N-diethyl-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide
5-(diethylamino)-N,N-diethyl-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide (PubChem CID 659721) has the molecular formula C23H31N3O
and a molecular weight of 365.52 g/mol. Its IUPAC name is 5-(diethylamino)-N,N-diethyl-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide.
Molecular Properties
| Compound Name | 5-(diethylamino)-N,N-diethyl-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide |
| PubChem CID | 659721 |
| Molecular Formula | C23H31N3O |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | 5-(diethylamino)-N,N-diethyl-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide |
| SMILES | CCN(CC)C(=O)N1c2ccccc2CC(N(CC)CC)c2ccccc21 |
| InChI | InChI=1S/C23H31N3O/c1-5-24(6-2)22-17-18-13-9-11-15-20(18)26(23(27)25(7-3)8-4)21-16-12-10-14-19(21)22/h9-16,22H,5-8,17H2,1-4H3 |
| InChIKey | DUXONKOEFSZBRM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(diethylamino)-N,N-diethyl-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(diethylamino)-N,N-diethyl-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide?
The IUPAC name of 5-(diethylamino)-N,N-diethyl-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide (CID 659721) is 5-(diethylamino)-N,N-diethyl-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide.
What is the SMILES notation for 5-(diethylamino)-N,N-diethyl-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide?
The canonical SMILES for 5-(diethylamino)-N,N-diethyl-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide is CCN(CC)C(=O)N1c2ccccc2CC(N(CC)CC)c2ccccc21.
What is the InChIKey of 5-(diethylamino)-N,N-diethyl-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide?
The InChIKey is DUXONKOEFSZBRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31N3O/c1-5-24(6-2)22-17-18-13-9-11-15-20(18)26(23(27)25(7-3)8-4)21-16-12-10-14-19(21)22/h9-16,22H,5-8,17H2,1-4H3.
What are the key properties of 5-(diethylamino)-N,N-diethyl-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide?
5-(diethylamino)-N,N-diethyl-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide has a molecular weight of 365.52 g/mol, XLogP of 5.23, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(diethylamino)-N,N-diethyl-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide is sourced from PubChem (CID 659721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).