C9H12F6N2O3 — CID 659749
4-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)carbamoylamino]butanoic acid (PubChem CID 659749) has the molecular formula C9H12F6N2O3 and a molecular weight of 310.19 g/mol. Its IUPAC name is 4-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)carbamoylamino]butanoic acid.
| Compound Name | 4-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 659749 |
| Molecular Formula | C9H12F6N2O3 |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 4-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)carbamoylamino]butanoic acid |
| SMILES | CC(NC(=O)NCCCC(=O)O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H12F6N2O3/c1-7(8(10,11)12,9(13,14)15)17-6(20)16-4-2-3-5(18)19/h2-4H2,1H3,(H,18,19)(H2,16,17,20) |
| InChIKey | LWQZZYGVFMLEFS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|