About N-benzylpyrimido[4,5-b][1,4]benzoxazepin-4-amine
N-benzylpyrimido[4,5-b][1,4]benzoxazepin-4-amine (PubChem CID 659753) has the molecular formula C18H14N4O
and a molecular weight of 302.34 g/mol. Its IUPAC name is N-benzylpyrimido[4,5-b][1,4]benzoxazepin-4-amine.
Molecular Properties
| Compound Name | N-benzylpyrimido[4,5-b][1,4]benzoxazepin-4-amine |
| PubChem CID | 659753 |
| Molecular Formula | C18H14N4O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N-benzylpyrimido[4,5-b][1,4]benzoxazepin-4-amine |
| SMILES | C1=Nc2c(NCc3ccccc3)ncnc2Oc2ccccc21 |
| InChI | InChI=1S/C18H14N4O/c1-2-6-13(7-3-1)10-20-17-16-18(22-12-21-17)23-15-9-5-4-8-14(15)11-19-16/h1-9,11-12H,10H2,(H,20,21,22) |
| InChIKey | KFKMEUNGWSASTR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-benzylpyrimido[4,5-b][1,4]benzoxazepin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzylpyrimido[4,5-b][1,4]benzoxazepin-4-amine?
The IUPAC name of N-benzylpyrimido[4,5-b][1,4]benzoxazepin-4-amine (CID 659753) is N-benzylpyrimido[4,5-b][1,4]benzoxazepin-4-amine.
What is the SMILES notation for N-benzylpyrimido[4,5-b][1,4]benzoxazepin-4-amine?
The canonical SMILES for N-benzylpyrimido[4,5-b][1,4]benzoxazepin-4-amine is C1=Nc2c(NCc3ccccc3)ncnc2Oc2ccccc21.
What is the InChIKey of N-benzylpyrimido[4,5-b][1,4]benzoxazepin-4-amine?
The InChIKey is KFKMEUNGWSASTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N4O/c1-2-6-13(7-3-1)10-20-17-16-18(22-12-21-17)23-15-9-5-4-8-14(15)11-19-16/h1-9,11-12H,10H2,(H,20,21,22).
What are the key properties of N-benzylpyrimido[4,5-b][1,4]benzoxazepin-4-amine?
N-benzylpyrimido[4,5-b][1,4]benzoxazepin-4-amine has a molecular weight of 302.34 g/mol, XLogP of 3.94, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzylpyrimido[4,5-b][1,4]benzoxazepin-4-amine is sourced from PubChem (CID 659753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).