C24H23N5O4 — CID 659765
5-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminomethyl]-6-hydroxy-1-(2-phenylethyl)pyrimidine-2,4-dione (PubChem CID 659765) has the molecular formula C24H23N5O4 and a molecular weight of 445.48 g/mol. Its IUPAC name is 5-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminomethyl]-6-hydroxy-1-(2-phenylethyl)pyrimidine-2,4-dione.
| Compound Name | 5-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminomethyl]-6-hydroxy-1-(2-phenylethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 659765 |
| Molecular Formula | C24H23N5O4 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 5-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminomethyl]-6-hydroxy-1-(2-phenylethyl)pyrimidine-2,4-dione |
| SMILES | Cc1c(/N=C/c2c(O)n(CCc3ccccc3)c(=O)[nH]c2=O)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C24H23N5O4/c1-16-20(23(32)29(27(16)2)18-11-7-4-8-12-18)25-15-19-21(30)26-24(33)28(22(19)31)14-13-17-9-5-3-6-10-17/h3-12,15,31H,13-14H2,1-2H3,(H,26,30,33)/b25-15+ |
| InChIKey | VQAIUAQDJCDXHH-MFKUBSTISA-N |
| XLogP | 2.03 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|