C15H10N2O4 — CID 659788
methyl 3-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)benzoate (PubChem CID 659788) has the molecular formula C15H10N2O4 and a molecular weight of 282.26 g/mol. Its IUPAC name is methyl 3-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)benzoate.
| Compound Name | methyl 3-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)benzoate |
|---|---|
| PubChem CID | 659788 |
| Molecular Formula | C15H10N2O4 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | methyl 3-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)benzoate |
| SMILES | COC(=O)c1cccc(N2C(=O)c3cccnc3C2=O)c1 |
| InChI | InChI=1S/C15H10N2O4/c1-21-15(20)9-4-2-5-10(8-9)17-13(18)11-6-3-7-16-12(11)14(17)19/h2-8H,1H3 |
| InChIKey | GGKYXFXUOWERTI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|